Mol:LBF24109SC02

From Jcbl.jp
Jump to: navigation, search

LBF24109SC02.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 26 25  0  0  0  0  0  0  0  0999 V2000 
    2.1360    0.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.8506    0.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.5651    0.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.4213    0.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.7069    0.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0051    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    4.2771    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    4.9891    0.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    4.2771    1.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7171    0.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.4291    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.1411    0.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.8531    0.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5651    0.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.2771    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.9891    0.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.9891   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.2746   -1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5601   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.8456   -1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.1312   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.4167   -1.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7022   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.0098   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.7217   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.4337   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  1  4  1  0 
  4  5  1  0 
  5  6  1  0 
  3  7  1  0 
  7  8  1  0 
  7  9  2  0 
  6 10  1  0 
 10 11  1  0 
 11 12  1  0 
 12 13  1  0 
 13 14  1  0 
 14 15  1  0 
 15 16  1  0 
 16 17  1  0 
 17 18  2  0 
 18 19  1  0 
 19 20  1  0 
 20 21  1  0 
 21 22  1  0 
 22 23  1  0 
 23 24  1  0 
 24 25  1  0 
 25 26  1  0 
S  SKP  6 
ID	LBF24109SC02 
FORMULA	C24H46O2 
EXACTMASS	366.349780716 
AVERAGEMASS	366.62084 
SMILES	C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC 
AUTODRAW	FALSE 
M  END
Personal tools