Mol:LBF20307PG41

From Jcbl.jp
Jump to: navigation, search

LBF20307PG41.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 24 24  0  0  0  0  0  0  0  0999 V2000 
    2.0612    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.7759    0.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.4903    0.4104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    2.7759    1.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    1.3466    0.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.6321    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0823    0.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7968    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.5088    0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.2208    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.0054    0.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.4903   -0.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.0054   -0.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.2208   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.5063   -0.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7919   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0799   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.6321   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.3441   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.0561   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.7681   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.4801   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.2595    1.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0799   -1.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  2  4  2  0 
  1  5  1  0 
  5  6  1  0 
  6  7  1  0 
  7  8  2  0 
  8  9  1  0 
 10  9  1  6 
 10 11  1  0 
 11 12  1  0 
 12 13  2  0 
 13 14  1  0 
 14 10  1  0 
 14 15  1  1 
 15 16  2  0 
 16 17  1  0 
 17 18  1  0 
 18 19  1  0 
 19 20  1  0 
 20 21  1  0 
 21 22  1  0 
 11 23  2  0 
 17 24  1  6 
S  SKP  6 
ID	LBF20307PG41 
FORMULA	C20H30O4 
EXACTMASS	334.21440944799997 
AVERAGEMASS	334.4498 
SMILES	C(CC[C@H](O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)C=CC(=O)1)CC 
AUTODRAW	FALSE 
M  END
Personal tools