Mol:LBF18208SC01

From Jcbl.jp
Jump to: navigation, search

LBF18208SC01.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 20 19  0  0  0  0  0  0  0  0999 V2000 
    4.9864   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    5.7011   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    6.4155   -0.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    5.7011    0.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    4.2718   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.5573   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.8428   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.1284   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.4164   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.7044   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0076   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7196   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.4316   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.1436   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.8556   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5676   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.2795   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.9915   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -5.7035   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -6.4155   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  2  4  2  0 
  1  5  1  0 
  5  6  1  0 
  6  7  1  0 
  7  8  1  0 
  8  9  1  0 
  9 10  1  0 
 10 11  2  0 
 11 12  1  0 
 12 13  2  0 
 13 14  1  0 
 14 15  1  0 
 15 16  1  0 
 16 17  1  0 
 17 18  1  0 
 18 19  1  0 
 19 20  1  0 
S  SKP  6 
ID	LBF18208SC01 
FORMULA	C18H32O2 
EXACTMASS	280.240230268 
AVERAGEMASS	280.44548000000003 
SMILES	CCCCCCCC=CC=CCCCCCCC(O)=O 
AUTODRAW	FALSE 
M  END
Personal tools