Mol:LBF15306CV01

From Jcbl.jp
Jump to: navigation, search

LBF15306CV01.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 22 22  0  0  0  0  0  0  0  0999 V2000 
   -1.5200    1.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.2645    0.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.2645   -0.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.0491   -0.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5340    0.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.0491    0.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.5652   -0.7581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.8535   -0.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.0285   -0.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.6860   -0.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.3981   -0.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.1100   -0.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.8220   -0.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.5340   -0.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.5108    1.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.2228    2.3925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7988    2.3925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.3041    1.6355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.4014   -1.0426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.7892   -1.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.0027   -2.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.9980   -1.3620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
  2  3  1  0 
  3  4  1  0 
  4  5  2  0 
  5  6  1  0 
  6  2  1  0 
  2  1  2  0 
  3  7  1  0 
  8  7  1  0 
  8  9  2  0 
  9 10  1  0 
 10 11  1  0 
 11 12  1  0 
 12 13  1  0 
 13 14  1  0 
 15 16  1  0 
 15 17  2  0 
  1 15  1  0 
  6 18  2  0 
  3 19  1  1 
 19 20  1  0 
 20 21  1  0 
 20 22  2  0 
S  SKP  6 
ID	LBF15306CV01 
FORMULA	C17H22O4 
EXACTMASS	290.151809192 
AVERAGEMASS	290.35418 
SMILES	CCCCCC=CC[C@](OC(C)=O)(C=1)C(=CC=O)C(=O)C1 
AUTODRAW	FALSE 
M  END
Personal tools