Mol:LBF18000OX06

From Jcbl.jp
Revision as of 15:11, 28 October 2010 by Editor (Talk | contribs)

(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Jump to: navigation, search

LBF18000OX06.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 21 20  0  0  0  0  0  0  0  0999 V2000 
    4.9990   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    5.7136   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    6.4281   -0.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    5.7136    0.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    4.2842   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.5699   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.8554   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.1409   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.4290   -0.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.7169   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.0024   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.7121   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.4265   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.1411   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.8557   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5702   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.2846   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.9991   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.0024    0.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -5.7137   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -6.4281   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  2  4  2  0 
  1  5  1  0 
  5  6  1  0 
  6  7  1  0 
  7  8  1  0 
  8  9  1  0 
  9 10  1  0 
 10 11  1  0 
 11 12  1  0 
 12 13  1  0 
 13 14  1  0 
 14 15  1  0 
 15 16  1  0 
 16 17  1  0 
 17 18  1  0 
 11 19  2  0 
 18 20  1  0 
 20 21  1  0 
S  SKP  6 
ID	LBF18000OX06 
FORMULA	C18H34O3 
EXACTMASS	298.25079495399996 
AVERAGEMASS	298.46076 
SMILES	CCCCCCCCCC(=O)CCCCCCCC(O)=O 
AUTODRAW	FALSE 
M  END
Personal tools